C42H42 — CID 101246721
1,3,5-tris[3,5-bis(prop-1-en-2-yl)phenyl]benzene (PubChem CID 101246721) has the molecular formula C42H42 and a molecular weight of 546.80 g/mol. Its IUPAC name is 1,3,5-tris[3,5-bis(prop-1-en-2-yl)phenyl]benzene.
| Compound Name | 1,3,5-tris[3,5-bis(prop-1-en-2-yl)phenyl]benzene |
|---|---|
| PubChem CID | 101246721 |
| Molecular Formula | C42H42 |
| Molecular Weight | 546.80 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | 1,3,5-tris[3,5-bis(prop-1-en-2-yl)phenyl]benzene |
| SMILES | C=C(C)c1cc(C(=C)C)cc(-c2cc(-c3cc(C(=C)C)cc(C(=C)C)c3)cc(-c3cc(C(=C)C)cc(C(=C)C)c3)c2)c1 |
| InChI | InChI=1S/C42H42/c1-25(2)31-13-32(26(3)4)17-37(16-31)40-22-41(38-18-33(27(5)6)14-34(19-38)28(7)8)24-42(23-40)39-20-35(29(9)10)15-36(21-39)30(11)12/h13-24H,1,3,5,7,9,11H2,2,4,6,8,10,12H3 |
| InChIKey | MJPDPURRCKNKKV-UHFFFAOYSA-N |
| XLogP | 12.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.80 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |