C13H16 — CID 142935126
1-methyl-3,5-bis(prop-1-en-2-yl)benzene (PubChem CID 142935126) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is 1-methyl-3,5-bis(prop-1-en-2-yl)benzene.
| Compound Name | 1-methyl-3,5-bis(prop-1-en-2-yl)benzene |
|---|---|
| PubChem CID | 142935126 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 1-methyl-3,5-bis(prop-1-en-2-yl)benzene |
| SMILES | C=C(C)c1cc(C)cc(C(=C)C)c1 |
| InChI | InChI=1S/C13H16/c1-9(2)12-6-11(5)7-13(8-12)10(3)4/h6-8H,1,3H2,2,4-5H3 |
| InChIKey | BLUYISXWVVSUIB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |