About 2-methylpropane;1-methyl-3-propan-2-yloxy-5-prop-1-en-2-ylbenzene
2-methylpropane;1-methyl-3-propan-2-yloxy-5-prop-1-en-2-ylbenzene (PubChem CID 142213493) has the molecular formula C17H28O
and a molecular weight of 248.41 g/mol. Its IUPAC name is 2-methylpropane;1-methyl-3-propan-2-yloxy-5-prop-1-en-2-ylbenzene.
Molecular Properties
| Compound Name | 2-methylpropane;1-methyl-3-propan-2-yloxy-5-prop-1-en-2-ylbenzene |
| PubChem CID | 142213493 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 2-methylpropane;1-methyl-3-propan-2-yloxy-5-prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1cc(C)cc(OC(C)C)c1.CC(C)C |
| InChI | InChI=1S/C13H18O.C4H10/c1-9(2)12-6-11(5)7-13(8-12)14-10(3)4;1-4(2)3/h6-8,10H,1H2,2-5H3;4H,1-3H3 |
| InChIKey | KOVTWXQUTDRMHE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylpropane;1-methyl-3-propan-2-yloxy-5-prop-1-en-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;1-methyl-3-propan-2-yloxy-5-prop-1-en-2-ylbenzene?
The IUPAC name of 2-methylpropane;1-methyl-3-propan-2-yloxy-5-prop-1-en-2-ylbenzene (CID 142213493) is 2-methylpropane;1-methyl-3-propan-2-yloxy-5-prop-1-en-2-ylbenzene.
What is the SMILES notation for 2-methylpropane;1-methyl-3-propan-2-yloxy-5-prop-1-en-2-ylbenzene?
The canonical SMILES for 2-methylpropane;1-methyl-3-propan-2-yloxy-5-prop-1-en-2-ylbenzene is C=C(C)c1cc(C)cc(OC(C)C)c1.CC(C)C.
What is the InChIKey of 2-methylpropane;1-methyl-3-propan-2-yloxy-5-prop-1-en-2-ylbenzene?
The InChIKey is KOVTWXQUTDRMHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O.C4H10/c1-9(2)12-6-11(5)7-13(8-12)14-10(3)4;1-4(2)3/h6-8,10H,1H2,2-5H3;4H,1-3H3.
What are the key properties of 2-methylpropane;1-methyl-3-propan-2-yloxy-5-prop-1-en-2-ylbenzene?
2-methylpropane;1-methyl-3-propan-2-yloxy-5-prop-1-en-2-ylbenzene has a molecular weight of 248.41 g/mol, XLogP of 5.48, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;1-methyl-3-propan-2-yloxy-5-prop-1-en-2-ylbenzene is sourced from PubChem (CID 142213493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).