About 3-methyl-5-prop-1-en-2-ylpyridine;propan-2-ylcyclobutane
3-methyl-5-prop-1-en-2-ylpyridine;propan-2-ylcyclobutane (PubChem CID 176949373) has the molecular formula C16H25N
and a molecular weight of 231.38 g/mol. Its IUPAC name is 3-methyl-5-prop-1-en-2-ylpyridine;propan-2-ylcyclobutane.
Molecular Properties
| Compound Name | 3-methyl-5-prop-1-en-2-ylpyridine;propan-2-ylcyclobutane |
| PubChem CID | 176949373 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 3-methyl-5-prop-1-en-2-ylpyridine;propan-2-ylcyclobutane |
| SMILES | C=C(C)c1cncc(C)c1.CC(C)C1CCC1 |
| InChI | InChI=1S/C9H11N.C7H14/c1-7(2)9-4-8(3)5-10-6-9;1-6(2)7-4-3-5-7/h4-6H,1H2,2-3H3;6-7H,3-5H2,1-2H3 |
| InChIKey | GVIBICJGTZJQNM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-5-prop-1-en-2-ylpyridine;propan-2-ylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-prop-1-en-2-ylpyridine;propan-2-ylcyclobutane?
The IUPAC name of 3-methyl-5-prop-1-en-2-ylpyridine;propan-2-ylcyclobutane (CID 176949373) is 3-methyl-5-prop-1-en-2-ylpyridine;propan-2-ylcyclobutane.
What is the SMILES notation for 3-methyl-5-prop-1-en-2-ylpyridine;propan-2-ylcyclobutane?
The canonical SMILES for 3-methyl-5-prop-1-en-2-ylpyridine;propan-2-ylcyclobutane is C=C(C)c1cncc(C)c1.CC(C)C1CCC1.
What is the InChIKey of 3-methyl-5-prop-1-en-2-ylpyridine;propan-2-ylcyclobutane?
The InChIKey is GVIBICJGTZJQNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N.C7H14/c1-7(2)9-4-8(3)5-10-6-9;1-6(2)7-4-3-5-7/h4-6H,1H2,2-3H3;6-7H,3-5H2,1-2H3.
What are the key properties of 3-methyl-5-prop-1-en-2-ylpyridine;propan-2-ylcyclobutane?
3-methyl-5-prop-1-en-2-ylpyridine;propan-2-ylcyclobutane has a molecular weight of 231.38 g/mol, XLogP of 4.87, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-prop-1-en-2-ylpyridine;propan-2-ylcyclobutane is sourced from PubChem (CID 176949373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).