C15H24 — CID 161065038
propan-2-ylcyclobutane;1,4-xylene (PubChem CID 161065038) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is propan-2-ylcyclobutane;1,4-xylene.
| Compound Name | propan-2-ylcyclobutane;1,4-xylene |
|---|---|
| PubChem CID | 161065038 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | propan-2-ylcyclobutane;1,4-xylene |
| SMILES | CC(C)C1CCC1.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10.C7H14/c1-7-3-5-8(2)6-4-7;1-6(2)7-4-3-5-7/h3-6H,1-2H3;6-7H,3-5H2,1-2H3 |
| InChIKey | UDXIMXVNATXOEI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |