About 1-cyclobutylethylbenzene
1-cyclobutylethylbenzene (PubChem CID 22024745) has the molecular formula C12H16
and a molecular weight of 160.26 g/mol. Its IUPAC name is 1-cyclobutylethylbenzene.
Molecular Properties
| Compound Name | 1-cyclobutylethylbenzene |
| PubChem CID | 22024745 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 1-cyclobutylethylbenzene |
| SMILES | CC(c1ccccc1)C1CCC1 |
| InChI | InChI=1S/C12H16/c1-10(12-8-5-9-12)11-6-3-2-4-7-11/h2-4,6-7,10,12H,5,8-9H2,1H3 |
| InChIKey | RIQGTOFTJRWXRX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-cyclobutylethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclobutylethylbenzene?
The IUPAC name of 1-cyclobutylethylbenzene (CID 22024745) is 1-cyclobutylethylbenzene.
What is the SMILES notation for 1-cyclobutylethylbenzene?
The canonical SMILES for 1-cyclobutylethylbenzene is CC(c1ccccc1)C1CCC1.
What is the InChIKey of 1-cyclobutylethylbenzene?
The InChIKey is RIQGTOFTJRWXRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16/c1-10(12-8-5-9-12)11-6-3-2-4-7-11/h2-4,6-7,10,12H,5,8-9H2,1H3.
What are the key properties of 1-cyclobutylethylbenzene?
1-cyclobutylethylbenzene has a molecular weight of 160.26 g/mol, XLogP of 3.59, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclobutylethylbenzene is sourced from PubChem (CID 22024745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).