About 3-(1-phenylethyl)oxolane
3-(1-phenylethyl)oxolane (PubChem CID 150323599) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-(1-phenylethyl)oxolane.
Molecular Properties
| Compound Name | 3-(1-phenylethyl)oxolane |
| PubChem CID | 150323599 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 3-(1-phenylethyl)oxolane |
| SMILES | CC(c1ccccc1)C1CCOC1 |
| InChI | InChI=1S/C12H16O/c1-10(12-7-8-13-9-12)11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3 |
| InChIKey | GODRLUKYWIYVBE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(1-phenylethyl)oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-phenylethyl)oxolane?
The IUPAC name of 3-(1-phenylethyl)oxolane (CID 150323599) is 3-(1-phenylethyl)oxolane.
What is the SMILES notation for 3-(1-phenylethyl)oxolane?
The canonical SMILES for 3-(1-phenylethyl)oxolane is CC(c1ccccc1)C1CCOC1.
What is the InChIKey of 3-(1-phenylethyl)oxolane?
The InChIKey is GODRLUKYWIYVBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-10(12-7-8-13-9-12)11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3.
What are the key properties of 3-(1-phenylethyl)oxolane?
3-(1-phenylethyl)oxolane has a molecular weight of 176.26 g/mol, XLogP of 2.83, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-phenylethyl)oxolane is sourced from PubChem (CID 150323599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).