About methane;3-methylbutan-2-ylbenzene;3-methylbutan-2-ylcyclohexane
methane;3-methylbutan-2-ylbenzene;3-methylbutan-2-ylcyclohexane (PubChem CID 162170584) has the molecular formula C23H42
and a molecular weight of 318.59 g/mol. Its IUPAC name is methane;3-methylbutan-2-ylbenzene;3-methylbutan-2-ylcyclohexane.
Molecular Properties
| Compound Name | methane;3-methylbutan-2-ylbenzene;3-methylbutan-2-ylcyclohexane |
| PubChem CID | 162170584 |
| Molecular Formula | C23H42 |
| Molecular Weight | 318.59 g/mol |
| Exact Mass | 318.33 |
| IUPAC Name | methane;3-methylbutan-2-ylbenzene;3-methylbutan-2-ylcyclohexane |
| SMILES | C.CC(C)C(C)C1CCCCC1.CC(C)C(C)c1ccccc1 |
| InChI | InChI=1S/C11H22.C11H16.CH4/c2*1-9(2)10(3)11-7-5-4-6-8-11;/h9-11H,4-8H2,1-3H3;4-10H,1-3H3;1H4 |
| InChIKey | ZNSRCXOHAIWDJZ-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.59 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze methane;3-methylbutan-2-ylbenzene;3-methylbutan-2-ylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-methylbutan-2-ylbenzene;3-methylbutan-2-ylcyclohexane?
The IUPAC name of methane;3-methylbutan-2-ylbenzene;3-methylbutan-2-ylcyclohexane (CID 162170584) is methane;3-methylbutan-2-ylbenzene;3-methylbutan-2-ylcyclohexane.
What is the SMILES notation for methane;3-methylbutan-2-ylbenzene;3-methylbutan-2-ylcyclohexane?
The canonical SMILES for methane;3-methylbutan-2-ylbenzene;3-methylbutan-2-ylcyclohexane is C.CC(C)C(C)C1CCCCC1.CC(C)C(C)c1ccccc1.
What is the InChIKey of methane;3-methylbutan-2-ylbenzene;3-methylbutan-2-ylcyclohexane?
The InChIKey is ZNSRCXOHAIWDJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22.C11H16.CH4/c2*1-9(2)10(3)11-7-5-4-6-8-11;/h9-11H,4-8H2,1-3H3;4-10H,1-3H3;1H4.
What are the key properties of methane;3-methylbutan-2-ylbenzene;3-methylbutan-2-ylcyclohexane?
methane;3-methylbutan-2-ylbenzene;3-methylbutan-2-ylcyclohexane has a molecular weight of 318.59 g/mol, XLogP of 7.94, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-methylbutan-2-ylbenzene;3-methylbutan-2-ylcyclohexane is sourced from PubChem (CID 162170584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).