C16H22 — CID 91412493
1,3-bis(1-cyclopropylethyl)benzene (PubChem CID 91412493) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 1,3-bis(1-cyclopropylethyl)benzene.
| Compound Name | 1,3-bis(1-cyclopropylethyl)benzene |
|---|---|
| PubChem CID | 91412493 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1,3-bis(1-cyclopropylethyl)benzene |
| SMILES | CC(c1cccc(C(C)C2CC2)c1)C1CC1 |
| InChI | InChI=1S/C16H22/c1-11(13-6-7-13)15-4-3-5-16(10-15)12(2)14-8-9-14/h3-5,10-14H,6-9H2,1-2H3 |
| InChIKey | ZVPSUEDMZAECNO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |