C13H18ClN — CID 83910984
3-[1-(3-chlorophenyl)ethyl]piperidine (PubChem CID 83910984) has the molecular formula C13H18ClN and a molecular weight of 223.75 g/mol. Its IUPAC name is 3-[1-(3-chlorophenyl)ethyl]piperidine.
| Compound Name | 3-[1-(3-chlorophenyl)ethyl]piperidine |
|---|---|
| PubChem CID | 83910984 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 3-[1-(3-chlorophenyl)ethyl]piperidine |
| SMILES | CC(c1cccc(Cl)c1)C1CCCNC1 |
| InChI | InChI=1S/C13H18ClN/c1-10(12-5-3-7-15-9-12)11-4-2-6-13(14)8-11/h2,4,6,8,10,12,15H,3,5,7,9H2,1H3 |
| InChIKey | RSYCXFMBYIHXPJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |