C16H23ClN2O2 — CID 91159436
2-[(3-chlorophenyl)-piperidin-3-ylmethoxy]butanamide (PubChem CID 91159436) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.83 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)-piperidin-3-ylmethoxy]butanamide.
| Compound Name | 2-[(3-chlorophenyl)-piperidin-3-ylmethoxy]butanamide |
|---|---|
| PubChem CID | 91159436 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-[(3-chlorophenyl)-piperidin-3-ylmethoxy]butanamide |
| SMILES | CCC(OC(c1cccc(Cl)c1)C1CCCNC1)C(N)=O |
| InChI | InChI=1S/C16H23ClN2O2/c1-2-14(16(18)20)21-15(12-6-4-8-19-10-12)11-5-3-7-13(17)9-11/h3,5,7,9,12,14-15,19H,2,4,6,8,10H2,1H3,(H2,18,20) |
| InChIKey | HMSBHFHLWYEUDO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |