C15H20ClNO2 — CID 54893052
ethyl 2-(3-chlorophenyl)-2-(cyclopentylamino)acetate (PubChem CID 54893052) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is ethyl 2-(3-chlorophenyl)-2-(cyclopentylamino)acetate.
| Compound Name | ethyl 2-(3-chlorophenyl)-2-(cyclopentylamino)acetate |
|---|---|
| PubChem CID | 54893052 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | ethyl 2-(3-chlorophenyl)-2-(cyclopentylamino)acetate |
| SMILES | CCOC(=O)C(NC1CCCC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H20ClNO2/c1-2-19-15(18)14(17-13-8-3-4-9-13)11-6-5-7-12(16)10-11/h5-7,10,13-14,17H,2-4,8-9H2,1H3 |
| InChIKey | QFBBVVPKTGCDTG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |