C16H21ClFNO2 — CID 114843746
ethyl 2-(4-chloro-2-fluorophenyl)-2-(cyclohexylamino)acetate (PubChem CID 114843746) has the molecular formula C16H21ClFNO2 and a molecular weight of 313.80 g/mol. Its IUPAC name is ethyl 2-(4-chloro-2-fluorophenyl)-2-(cyclohexylamino)acetate.
| Compound Name | ethyl 2-(4-chloro-2-fluorophenyl)-2-(cyclohexylamino)acetate |
|---|---|
| PubChem CID | 114843746 |
| Molecular Formula | C16H21ClFNO2 |
| Molecular Weight | 313.80 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | ethyl 2-(4-chloro-2-fluorophenyl)-2-(cyclohexylamino)acetate |
| SMILES | CCOC(=O)C(NC1CCCCC1)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C16H21ClFNO2/c1-2-21-16(20)15(19-12-6-4-3-5-7-12)13-9-8-11(17)10-14(13)18/h8-10,12,15,19H,2-7H2,1H3 |
| InChIKey | FLRHIZCUYJGHPH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.80 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |