C15H19BrFNO2 — CID 60998047
ethyl 2-(5-bromo-2-fluorophenyl)-2-(cyclopentylamino)acetate (PubChem CID 60998047) has the molecular formula C15H19BrFNO2 and a molecular weight of 344.22 g/mol. Its IUPAC name is ethyl 2-(5-bromo-2-fluorophenyl)-2-(cyclopentylamino)acetate.
| Compound Name | ethyl 2-(5-bromo-2-fluorophenyl)-2-(cyclopentylamino)acetate |
|---|---|
| PubChem CID | 60998047 |
| Molecular Formula | C15H19BrFNO2 |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | ethyl 2-(5-bromo-2-fluorophenyl)-2-(cyclopentylamino)acetate |
| SMILES | CCOC(=O)C(NC1CCCC1)c1cc(Br)ccc1F |
| InChI | InChI=1S/C15H19BrFNO2/c1-2-20-15(19)14(18-11-5-3-4-6-11)12-9-10(16)7-8-13(12)17/h7-9,11,14,18H,2-6H2,1H3 |
| InChIKey | BRMVLIWZPRZLAA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |