C13H17BrFNO3 — CID 62542248
ethyl 2-(5-bromo-2-fluorophenyl)-2-(2-methoxyethylamino)acetate (PubChem CID 62542248) has the molecular formula C13H17BrFNO3 and a molecular weight of 334.19 g/mol. Its IUPAC name is ethyl 2-(5-bromo-2-fluorophenyl)-2-(2-methoxyethylamino)acetate.
| Compound Name | ethyl 2-(5-bromo-2-fluorophenyl)-2-(2-methoxyethylamino)acetate |
|---|---|
| PubChem CID | 62542248 |
| Molecular Formula | C13H17BrFNO3 |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | ethyl 2-(5-bromo-2-fluorophenyl)-2-(2-methoxyethylamino)acetate |
| SMILES | CCOC(=O)C(NCCOC)c1cc(Br)ccc1F |
| InChI | InChI=1S/C13H17BrFNO3/c1-3-19-13(17)12(16-6-7-18-2)10-8-9(14)4-5-11(10)15/h4-5,8,12,16H,3,6-7H2,1-2H3 |
| InChIKey | MNNBFNBIYXKSEM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|