C13H18FNO4 — CID 107690318
ethyl 2-(3-fluoro-4-hydroxyphenyl)-2-(2-methoxyethylamino)acetate (PubChem CID 107690318) has the molecular formula C13H18FNO4 and a molecular weight of 271.29 g/mol. Its IUPAC name is ethyl 2-(3-fluoro-4-hydroxyphenyl)-2-(2-methoxyethylamino)acetate.
| Compound Name | ethyl 2-(3-fluoro-4-hydroxyphenyl)-2-(2-methoxyethylamino)acetate |
|---|---|
| PubChem CID | 107690318 |
| Molecular Formula | C13H18FNO4 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | ethyl 2-(3-fluoro-4-hydroxyphenyl)-2-(2-methoxyethylamino)acetate |
| SMILES | CCOC(=O)C(NCCOC)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C13H18FNO4/c1-3-19-13(17)12(15-6-7-18-2)9-4-5-11(16)10(14)8-9/h4-5,8,12,15-16H,3,6-7H2,1-2H3 |
| InChIKey | AGIKFUYNZDEHPH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|