C14H20FNO4 — CID 65096691
ethyl 2-(3-fluoro-4-methoxyphenyl)-2-(2-methoxyethylamino)acetate (PubChem CID 65096691) has the molecular formula C14H20FNO4 and a molecular weight of 285.31 g/mol. Its IUPAC name is ethyl 2-(3-fluoro-4-methoxyphenyl)-2-(2-methoxyethylamino)acetate.
| Compound Name | ethyl 2-(3-fluoro-4-methoxyphenyl)-2-(2-methoxyethylamino)acetate |
|---|---|
| PubChem CID | 65096691 |
| Molecular Formula | C14H20FNO4 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | ethyl 2-(3-fluoro-4-methoxyphenyl)-2-(2-methoxyethylamino)acetate |
| SMILES | CCOC(=O)C(NCCOC)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C14H20FNO4/c1-4-20-14(17)13(16-7-8-18-2)10-5-6-12(19-3)11(15)9-10/h5-6,9,13,16H,4,7-8H2,1-3H3 |
| InChIKey | SZCAPLGIOIOHDP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|