C19H20BrFN2O4 — CID 99786695
ethyl (2S)-2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-(3-fluoro-4-methoxyphenyl)acetate (PubChem CID 99786695) has the molecular formula C19H20BrFN2O4 and a molecular weight of 439.28 g/mol. Its IUPAC name is ethyl (2S)-2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-(3-fluoro-4-methoxyphenyl)acetate.
| Compound Name | ethyl (2S)-2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-(3-fluoro-4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 99786695 |
| Molecular Formula | C19H20BrFN2O4 |
| Molecular Weight | 439.28 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | ethyl (2S)-2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-(3-fluoro-4-methoxyphenyl)acetate |
| SMILES | CCOC(=O)[C@@H](NCC(=O)Nc1ccccc1Br)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C19H20BrFN2O4/c1-3-27-19(25)18(12-8-9-16(26-2)14(21)10-12)22-11-17(24)23-15-7-5-4-6-13(15)20/h4-10,18,22H,3,11H2,1-2H3,(H,23,24)/t18-/m0/s1 |
| InChIKey | PMNMDGAAGXDEOW-SFHVURJKSA-N |
| XLogP | 3.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |