C12H15FO5 — CID 171865985
ethyl 3-(3-fluoro-4-methoxyphenyl)-2,3-dihydroxypropanoate (PubChem CID 171865985) has the molecular formula C12H15FO5 and a molecular weight of 258.24 g/mol. Its IUPAC name is ethyl 3-(3-fluoro-4-methoxyphenyl)-2,3-dihydroxypropanoate.
| Compound Name | ethyl 3-(3-fluoro-4-methoxyphenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171865985 |
| Molecular Formula | C12H15FO5 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | ethyl 3-(3-fluoro-4-methoxyphenyl)-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)C(O)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C12H15FO5/c1-3-18-12(16)11(15)10(14)7-4-5-9(17-2)8(13)6-7/h4-6,10-11,14-15H,3H2,1-2H3 |
| InChIKey | HOXYIQFCHVELKT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |