C13H16O7 — CID 171866710
4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-2-methoxybenzoic acid (PubChem CID 171866710) has the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. Its IUPAC name is 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-2-methoxybenzoic acid.
| Compound Name | 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 171866710 |
| Molecular Formula | C13H16O7 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 4-(3-ethoxy-1,2-dihydroxy-3-oxopropyl)-2-methoxybenzoic acid |
| SMILES | CCOC(=O)C(O)C(O)c1ccc(C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C13H16O7/c1-3-20-13(18)11(15)10(14)7-4-5-8(12(16)17)9(6-7)19-2/h4-6,10-11,14-15H,3H2,1-2H3,(H,16,17) |
| InChIKey | ZNZFJPNSAAWUES-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |