C12H16O6 — CID 170825209
3-(4-ethoxy-3-methoxyphenyl)-2,3-dihydroxypropanoic acid (PubChem CID 170825209) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is 3-(4-ethoxy-3-methoxyphenyl)-2,3-dihydroxypropanoic acid.
| Compound Name | 3-(4-ethoxy-3-methoxyphenyl)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 170825209 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 3-(4-ethoxy-3-methoxyphenyl)-2,3-dihydroxypropanoic acid |
| SMILES | CCOc1ccc(C(O)C(O)C(=O)O)cc1OC |
| InChI | InChI=1S/C12H16O6/c1-3-18-8-5-4-7(6-9(8)17-2)10(13)11(14)12(15)16/h4-6,10-11,13-14H,3H2,1-2H3,(H,15,16) |
| InChIKey | CIQIWQXVVXXYNO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |