C15H19BrClNO2 — CID 66157260
methyl 2-(2-bromo-5-chlorophenyl)-2-(cyclohexylamino)acetate (PubChem CID 66157260) has the molecular formula C15H19BrClNO2 and a molecular weight of 360.68 g/mol. Its IUPAC name is methyl 2-(2-bromo-5-chlorophenyl)-2-(cyclohexylamino)acetate.
| Compound Name | methyl 2-(2-bromo-5-chlorophenyl)-2-(cyclohexylamino)acetate |
|---|---|
| PubChem CID | 66157260 |
| Molecular Formula | C15H19BrClNO2 |
| Molecular Weight | 360.68 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | methyl 2-(2-bromo-5-chlorophenyl)-2-(cyclohexylamino)acetate |
| SMILES | COC(=O)C(NC1CCCCC1)c1cc(Cl)ccc1Br |
| InChI | InChI=1S/C15H19BrClNO2/c1-20-15(19)14(18-11-5-3-2-4-6-11)12-9-10(17)7-8-13(12)16/h7-9,11,14,18H,2-6H2,1H3 |
| InChIKey | YLNMRTUYFWXVGI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.68 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |