C14H17BrClNO2 — CID 66157058
methyl 2-(2-bromo-5-chlorophenyl)-2-(cyclopentylamino)acetate (PubChem CID 66157058) has the molecular formula C14H17BrClNO2 and a molecular weight of 346.65 g/mol. Its IUPAC name is methyl 2-(2-bromo-5-chlorophenyl)-2-(cyclopentylamino)acetate.
| Compound Name | methyl 2-(2-bromo-5-chlorophenyl)-2-(cyclopentylamino)acetate |
|---|---|
| PubChem CID | 66157058 |
| Molecular Formula | C14H17BrClNO2 |
| Molecular Weight | 346.65 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | methyl 2-(2-bromo-5-chlorophenyl)-2-(cyclopentylamino)acetate |
| SMILES | COC(=O)C(NC1CCCC1)c1cc(Cl)ccc1Br |
| InChI | InChI=1S/C14H17BrClNO2/c1-19-14(18)13(17-10-4-2-3-5-10)11-8-9(16)6-7-12(11)15/h6-8,10,13,17H,2-5H2,1H3 |
| InChIKey | BGTRWNHMJYVWPI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.65 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |