C16H21ClO3 — CID 148697514
ethyl 3-(3-chlorophenyl)-3-cyclopentyloxypropanoate (PubChem CID 148697514) has the molecular formula C16H21ClO3 and a molecular weight of 296.79 g/mol. Its IUPAC name is ethyl 3-(3-chlorophenyl)-3-cyclopentyloxypropanoate.
| Compound Name | ethyl 3-(3-chlorophenyl)-3-cyclopentyloxypropanoate |
|---|---|
| PubChem CID | 148697514 |
| Molecular Formula | C16H21ClO3 |
| Molecular Weight | 296.79 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | ethyl 3-(3-chlorophenyl)-3-cyclopentyloxypropanoate |
| SMILES | CCOC(=O)CC(OC1CCCC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H21ClO3/c1-2-19-16(18)11-15(20-14-8-3-4-9-14)12-6-5-7-13(17)10-12/h5-7,10,14-15H,2-4,8-9,11H2,1H3 |
| InChIKey | YIPXYHNRFDRXMU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.79 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |