C23H28ClNO3 — CID 10069658
ethyl 3-[4-[(3-chlorophenyl)-phenylmethoxy]piperidin-1-yl]propanoate (PubChem CID 10069658) has the molecular formula C23H28ClNO3 and a molecular weight of 401.93 g/mol. Its IUPAC name is ethyl 3-[4-[(3-chlorophenyl)-phenylmethoxy]piperidin-1-yl]propanoate.
| Compound Name | ethyl 3-[4-[(3-chlorophenyl)-phenylmethoxy]piperidin-1-yl]propanoate |
|---|---|
| PubChem CID | 10069658 |
| Molecular Formula | C23H28ClNO3 |
| Molecular Weight | 401.93 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | ethyl 3-[4-[(3-chlorophenyl)-phenylmethoxy]piperidin-1-yl]propanoate |
| SMILES | CCOC(=O)CCN1CCC(OC(c2ccccc2)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C23H28ClNO3/c1-2-27-22(26)13-16-25-14-11-21(12-15-25)28-23(18-7-4-3-5-8-18)19-9-6-10-20(24)17-19/h3-10,17,21,23H,2,11-16H2,1H3 |
| InChIKey | QJCCZVKGYMTHMH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.93 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |