C17H22ClNO3 — CID 1481391
ethyl N-[(R)-(3-chlorophenyl)-[(1R)-2-oxocycloheptyl]methyl]carbamate (PubChem CID 1481391) has the molecular formula C17H22ClNO3 and a molecular weight of 323.82 g/mol. Its IUPAC name is ethyl N-[(R)-(3-chlorophenyl)-[(1R)-2-oxocycloheptyl]methyl]carbamate.
| Compound Name | ethyl N-[(R)-(3-chlorophenyl)-[(1R)-2-oxocycloheptyl]methyl]carbamate |
|---|---|
| PubChem CID | 1481391 |
| Molecular Formula | C17H22ClNO3 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | ethyl N-[(R)-(3-chlorophenyl)-[(1R)-2-oxocycloheptyl]methyl]carbamate |
| SMILES | CCOC(=O)N[C@@H](c1cccc(Cl)c1)[C@H]1CCCCCC1=O |
| InChI | InChI=1S/C17H22ClNO3/c1-2-22-17(21)19-16(12-7-6-8-13(18)11-12)14-9-4-3-5-10-15(14)20/h6-8,11,14,16H,2-5,9-10H2,1H3,(H,19,21)/t14-,16-/m0/s1 |
| InChIKey | VTSQWOUUCINPRV-HOCLYGCPSA-N |
| XLogP | 4.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |