C21H21ClO2 — CID 102230840
(2S)-2-[(1R)-3-(3-chlorophenyl)-3-oxo-1-phenylpropyl]cyclohexan-1-one (PubChem CID 102230840) has the molecular formula C21H21ClO2 and a molecular weight of 340.85 g/mol. Its IUPAC name is (2S)-2-[(1R)-3-(3-chlorophenyl)-3-oxo-1-phenylpropyl]cyclohexan-1-one.
| Compound Name | (2S)-2-[(1R)-3-(3-chlorophenyl)-3-oxo-1-phenylpropyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 102230840 |
| Molecular Formula | C21H21ClO2 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (2S)-2-[(1R)-3-(3-chlorophenyl)-3-oxo-1-phenylpropyl]cyclohexan-1-one |
| SMILES | O=C(C[C@@H](c1ccccc1)[C@@H]1CCCCC1=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H21ClO2/c22-17-10-6-9-16(13-17)21(24)14-19(15-7-2-1-3-8-15)18-11-4-5-12-20(18)23/h1-3,6-10,13,18-19H,4-5,11-12,14H2/t18-,19-/m0/s1 |
| InChIKey | ZFTFRPWZSIFIPG-OALUTQOASA-N |
| XLogP | 5.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |