C20H19NO4 — CID 102108457
(2S)-2-[(1R)-1-(4-nitrophenyl)-3-oxo-3-phenylpropyl]cyclopentan-1-one (PubChem CID 102108457) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is (2S)-2-[(1R)-1-(4-nitrophenyl)-3-oxo-3-phenylpropyl]cyclopentan-1-one.
| Compound Name | (2S)-2-[(1R)-1-(4-nitrophenyl)-3-oxo-3-phenylpropyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 102108457 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (2S)-2-[(1R)-1-(4-nitrophenyl)-3-oxo-3-phenylpropyl]cyclopentan-1-one |
| SMILES | O=C(C[C@@H](c1ccc([N+](=O)[O-])cc1)[C@@H]1CCCC1=O)c1ccccc1 |
| InChI | InChI=1S/C20H19NO4/c22-19-8-4-7-17(19)18(13-20(23)15-5-2-1-3-6-15)14-9-11-16(12-10-14)21(24)25/h1-3,5-6,9-12,17-18H,4,7-8,13H2/t17-,18-/m0/s1 |
| InChIKey | BESAHKWKWKAUKG-ROUUACIJSA-N |
| XLogP | 4.32 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|