C22H23NO4 — CID 122211158
3-(1-nitro-4-oxo-2,4-diphenylbutyl)cyclohexan-1-one (PubChem CID 122211158) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 3-(1-nitro-4-oxo-2,4-diphenylbutyl)cyclohexan-1-one.
| Compound Name | 3-(1-nitro-4-oxo-2,4-diphenylbutyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 122211158 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 3-(1-nitro-4-oxo-2,4-diphenylbutyl)cyclohexan-1-one |
| SMILES | O=C1CCCC(C(C(CC(=O)c2ccccc2)c2ccccc2)[N+](=O)[O-])C1 |
| InChI | InChI=1S/C22H23NO4/c24-19-13-7-12-18(14-19)22(23(26)27)20(16-8-3-1-4-9-16)15-21(25)17-10-5-2-6-11-17/h1-6,8-11,18,20,22H,7,12-15H2 |
| InChIKey | RCCLISVJXJGIJI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|