C23H19BrO2 — CID 13250146
2-bromo-1,3,5-triphenylpentane-1,5-dione (PubChem CID 13250146) has the molecular formula C23H19BrO2 and a molecular weight of 407.31 g/mol. Its IUPAC name is 2-bromo-1,3,5-triphenylpentane-1,5-dione.
| Compound Name | 2-bromo-1,3,5-triphenylpentane-1,5-dione |
|---|---|
| PubChem CID | 13250146 |
| Molecular Formula | C23H19BrO2 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 2-bromo-1,3,5-triphenylpentane-1,5-dione |
| SMILES | O=C(CC(c1ccccc1)C(Br)C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H19BrO2/c24-22(23(26)19-14-8-3-9-15-19)20(17-10-4-1-5-11-17)16-21(25)18-12-6-2-7-13-18/h1-15,20,22H,16H2 |
| InChIKey | ZRUURXMUJOUJSS-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|