C35H29NO — CID 27153365
(3R,4R)-4-(benzhydrylideneamino)-1,3,4-triphenylbutan-1-one (PubChem CID 27153365) has the molecular formula C35H29NO and a molecular weight of 479.62 g/mol. Its IUPAC name is (3R,4R)-4-(benzhydrylideneamino)-1,3,4-triphenylbutan-1-one.
| Compound Name | (3R,4R)-4-(benzhydrylideneamino)-1,3,4-triphenylbutan-1-one |
|---|---|
| PubChem CID | 27153365 |
| Molecular Formula | C35H29NO |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | (3R,4R)-4-(benzhydrylideneamino)-1,3,4-triphenylbutan-1-one |
| SMILES | O=C(C[C@H](c1ccccc1)[C@@H](N=C(c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H29NO/c37-33(28-18-8-2-9-19-28)26-32(27-16-6-1-7-17-27)35(31-24-14-5-15-25-31)36-34(29-20-10-3-11-21-29)30-22-12-4-13-23-30/h1-25,32,35H,26H2/t32-,35+/m1/s1 |
| InChIKey | FWTIDJFJLMPZMZ-LDNVYYCDSA-N |
| XLogP | 8.32 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|