C35H35NO4 — CID 87428032
tert-butyl (2R,3S)-2-(benzhydrylideneamino)-5-(4-methoxyphenyl)-5-oxo-3-phenylpentanoate (PubChem CID 87428032) has the molecular formula C35H35NO4 and a molecular weight of 533.67 g/mol. Its IUPAC name is tert-butyl (2R,3S)-2-(benzhydrylideneamino)-5-(4-methoxyphenyl)-5-oxo-3-phenylpentanoate.
| Compound Name | tert-butyl (2R,3S)-2-(benzhydrylideneamino)-5-(4-methoxyphenyl)-5-oxo-3-phenylpentanoate |
|---|---|
| PubChem CID | 87428032 |
| Molecular Formula | C35H35NO4 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | tert-butyl (2R,3S)-2-(benzhydrylideneamino)-5-(4-methoxyphenyl)-5-oxo-3-phenylpentanoate |
| SMILES | COc1ccc(C(=O)C[C@@H](c2ccccc2)[C@@H](N=C(c2ccccc2)c2ccccc2)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C35H35NO4/c1-35(2,3)40-34(38)33(36-32(27-16-10-6-11-17-27)28-18-12-7-13-19-28)30(25-14-8-5-9-15-25)24-31(37)26-20-22-29(39-4)23-21-26/h5-23,30,33H,24H2,1-4H3/t30-,33+/m0/s1 |
| InChIKey | YJVNZLGYPDAMRQ-BZKUTMRRSA-N |
| XLogP | 7.30 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|