C29H31NO4 — CID 11465269
1-O-ethyl 5-O-propan-2-yl 2-(benzhydrylideneamino)-3-phenylpentanedioate (PubChem CID 11465269) has the molecular formula C29H31NO4 and a molecular weight of 457.57 g/mol. Its IUPAC name is 1-O-ethyl 5-O-propan-2-yl 2-(benzhydrylideneamino)-3-phenylpentanedioate.
| Compound Name | 1-O-ethyl 5-O-propan-2-yl 2-(benzhydrylideneamino)-3-phenylpentanedioate |
|---|---|
| PubChem CID | 11465269 |
| Molecular Formula | C29H31NO4 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 1-O-ethyl 5-O-propan-2-yl 2-(benzhydrylideneamino)-3-phenylpentanedioate |
| SMILES | CCOC(=O)C(N=C(c1ccccc1)c1ccccc1)C(CC(=O)OC(C)C)c1ccccc1 |
| InChI | InChI=1S/C29H31NO4/c1-4-33-29(32)28(25(20-26(31)34-21(2)3)22-14-8-5-9-15-22)30-27(23-16-10-6-11-17-23)24-18-12-7-13-19-24/h5-19,21,25,28H,4,20H2,1-3H3 |
| InChIKey | GKPLKWGEDVNAEC-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|