C17H23NO4S2 — CID 10690466
1-O-ethyl 5-O-methyl (2S,3R)-2-[bis(methylsulfanyl)methylideneamino]-3-phenylpentanedioate (PubChem CID 10690466) has the molecular formula C17H23NO4S2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-O-ethyl 5-O-methyl (2S,3R)-2-[bis(methylsulfanyl)methylideneamino]-3-phenylpentanedioate.
| Compound Name | 1-O-ethyl 5-O-methyl (2S,3R)-2-[bis(methylsulfanyl)methylideneamino]-3-phenylpentanedioate |
|---|---|
| PubChem CID | 10690466 |
| Molecular Formula | C17H23NO4S2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 1-O-ethyl 5-O-methyl (2S,3R)-2-[bis(methylsulfanyl)methylideneamino]-3-phenylpentanedioate |
| SMILES | CCOC(=O)[C@@H](N=C(SC)SC)[C@H](CC(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C17H23NO4S2/c1-5-22-16(20)15(18-17(23-3)24-4)13(11-14(19)21-2)12-9-7-6-8-10-12/h6-10,13,15H,5,11H2,1-4H3/t13-,15+/m1/s1 |
| InChIKey | OXWDNHMDBPELKU-HIFRSBDPSA-N |
| XLogP | 3.35 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|