C13H21NO6S2 — CID 10617927
1-O-ethyl 2-O,3-O-dimethyl (1S,2S)-1-[bis(methylsulfanyl)methylideneamino]propane-1,2,3-tricarboxylate (PubChem CID 10617927) has the molecular formula C13H21NO6S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-O-ethyl 2-O,3-O-dimethyl (1S,2S)-1-[bis(methylsulfanyl)methylideneamino]propane-1,2,3-tricarboxylate.
| Compound Name | 1-O-ethyl 2-O,3-O-dimethyl (1S,2S)-1-[bis(methylsulfanyl)methylideneamino]propane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 10617927 |
| Molecular Formula | C13H21NO6S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 1-O-ethyl 2-O,3-O-dimethyl (1S,2S)-1-[bis(methylsulfanyl)methylideneamino]propane-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)[C@@H](N=C(SC)SC)[C@H](CC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C13H21NO6S2/c1-6-20-12(17)10(14-13(21-4)22-5)8(11(16)19-3)7-9(15)18-2/h8,10H,6-7H2,1-5H3/t8-,10-/m0/s1 |
| InChIKey | DONVTXWIDGJNOW-WPRPVWTQSA-N |
| XLogP | 1.35 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|