C18H20F3NO6 — CID 134999102
1-O-ethyl 2-O,3-O-dimethyl 1-[[4-(trifluoromethyl)phenyl]methylideneamino]propane-1,2,3-tricarboxylate (PubChem CID 134999102) has the molecular formula C18H20F3NO6 and a molecular weight of 403.35 g/mol. Its IUPAC name is 1-O-ethyl 2-O,3-O-dimethyl 1-[[4-(trifluoromethyl)phenyl]methylideneamino]propane-1,2,3-tricarboxylate.
| Compound Name | 1-O-ethyl 2-O,3-O-dimethyl 1-[[4-(trifluoromethyl)phenyl]methylideneamino]propane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 134999102 |
| Molecular Formula | C18H20F3NO6 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 1-O-ethyl 2-O,3-O-dimethyl 1-[[4-(trifluoromethyl)phenyl]methylideneamino]propane-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)C(/N=C/c1ccc(C(F)(F)F)cc1)C(CC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C18H20F3NO6/c1-4-28-17(25)15(13(16(24)27-3)9-14(23)26-2)22-10-11-5-7-12(8-6-11)18(19,20)21/h5-8,10,13,15H,4,9H2,1-3H3/b22-10+ |
| InChIKey | MPDAZWFJGKGJDO-LSHDLFTRSA-N |
| XLogP | 2.41 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|