C21H19F3O2 — CID 101488311
ethyl (E,3E)-5-phenyl-3-[[4-(trifluoromethyl)phenyl]methylidene]pent-4-enoate (PubChem CID 101488311) has the molecular formula C21H19F3O2 and a molecular weight of 360.38 g/mol. Its IUPAC name is ethyl (E,3E)-5-phenyl-3-[[4-(trifluoromethyl)phenyl]methylidene]pent-4-enoate.
| Compound Name | ethyl (E,3E)-5-phenyl-3-[[4-(trifluoromethyl)phenyl]methylidene]pent-4-enoate |
|---|---|
| PubChem CID | 101488311 |
| Molecular Formula | C21H19F3O2 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | ethyl (E,3E)-5-phenyl-3-[[4-(trifluoromethyl)phenyl]methylidene]pent-4-enoate |
| SMILES | CCOC(=O)CC(/C=C/c1ccccc1)=C\c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19F3O2/c1-2-26-20(25)15-18(9-8-16-6-4-3-5-7-16)14-17-10-12-19(13-11-17)21(22,23)24/h3-14H,2,15H2,1H3/b9-8+,18-14- |
| InChIKey | ZSJYJVXOTLVWNT-LWUAIRSFSA-N |
| XLogP | 5.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|