C13H13ClF2O2 — CID 10989470
ethyl (Z)-4-chloro-3,3-difluoro-5-phenylpent-4-enoate (PubChem CID 10989470) has the molecular formula C13H13ClF2O2 and a molecular weight of 274.69 g/mol. Its IUPAC name is ethyl (Z)-4-chloro-3,3-difluoro-5-phenylpent-4-enoate.
| Compound Name | ethyl (Z)-4-chloro-3,3-difluoro-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 10989470 |
| Molecular Formula | C13H13ClF2O2 |
| Molecular Weight | 274.69 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | ethyl (Z)-4-chloro-3,3-difluoro-5-phenylpent-4-enoate |
| SMILES | CCOC(=O)CC(F)(F)/C(Cl)=C/c1ccccc1 |
| InChI | InChI=1S/C13H13ClF2O2/c1-2-18-12(17)9-13(15,16)11(14)8-10-6-4-3-5-7-10/h3-8H,2,9H2,1H3/b11-8- |
| InChIKey | CEUJVZZNFDQDLG-FLIBITNWSA-N |
| XLogP | 3.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.69 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |