C19H19NO3 — CID 4270908
ethyl 2-(2,3-diphenylprop-2-enoylamino)acetate (PubChem CID 4270908) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is ethyl 2-(2,3-diphenylprop-2-enoylamino)acetate.
| Compound Name | ethyl 2-(2,3-diphenylprop-2-enoylamino)acetate |
|---|---|
| PubChem CID | 4270908 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | ethyl 2-(2,3-diphenylprop-2-enoylamino)acetate |
| SMILES | CCOC(=O)CNC(=O)C(=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H19NO3/c1-2-23-18(21)14-20-19(22)17(16-11-7-4-8-12-16)13-15-9-5-3-6-10-15/h3-13H,2,14H2,1H3,(H,20,22) |
| InChIKey | LXITYCGIIONADP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|