C12H11F5O — CID 15651904
[(Z)-2-ethoxy-3,3,4,4,4-pentafluorobut-1-enyl]benzene (PubChem CID 15651904) has the molecular formula C12H11F5O and a molecular weight of 266.21 g/mol. Its IUPAC name is [(Z)-2-ethoxy-3,3,4,4,4-pentafluorobut-1-enyl]benzene.
| Compound Name | [(Z)-2-ethoxy-3,3,4,4,4-pentafluorobut-1-enyl]benzene |
|---|---|
| PubChem CID | 15651904 |
| Molecular Formula | C12H11F5O |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | [(Z)-2-ethoxy-3,3,4,4,4-pentafluorobut-1-enyl]benzene |
| SMILES | CCO/C(=C\c1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H11F5O/c1-2-18-10(11(13,14)12(15,16)17)8-9-6-4-3-5-7-9/h3-8H,2H2,1H3/b10-8- |
| InChIKey | IKXGPZKORSHOLF-NTMALXAHSA-N |
| XLogP | 4.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|