C15H11F9O4S — CID 23236901
ethyl (E)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-3-phenylprop-2-enoate (PubChem CID 23236901) has the molecular formula C15H11F9O4S and a molecular weight of 458.30 g/mol. Its IUPAC name is ethyl (E)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-3-phenylprop-2-enoate.
| Compound Name | ethyl (E)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 23236901 |
| Molecular Formula | C15H11F9O4S |
| Molecular Weight | 458.30 g/mol |
| Exact Mass | 458.02 |
| IUPAC Name | ethyl (E)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-3-phenylprop-2-enoate |
| SMILES | CCOC(=O)/C(=C\c1ccccc1)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H11F9O4S/c1-2-28-11(25)10(8-9-6-4-3-5-7-9)29(26,27)15(23,24)13(18,19)12(16,17)14(20,21)22/h3-8H,2H2,1H3/b10-8+ |
| InChIKey | YABRIPWTUXNAPG-CSKARUKUSA-N |
| XLogP | 4.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.30 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|