C22H22F3N3O3 — CID 122384911
ethyl 2-[2-[N-(4-methylphenyl)-C-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]carbonimidoyl]hydrazinyl]acetate (PubChem CID 122384911) has the molecular formula C22H22F3N3O3 and a molecular weight of 433.43 g/mol. Its IUPAC name is ethyl 2-[2-[N-(4-methylphenyl)-C-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]carbonimidoyl]hydrazinyl]acetate.
| Compound Name | ethyl 2-[2-[N-(4-methylphenyl)-C-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]carbonimidoyl]hydrazinyl]acetate |
|---|---|
| PubChem CID | 122384911 |
| Molecular Formula | C22H22F3N3O3 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | ethyl 2-[2-[N-(4-methylphenyl)-C-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]carbonimidoyl]hydrazinyl]acetate |
| SMILES | CCOC(=O)CNN/C(=N\c1ccc(C)cc1)C(=O)/C=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H22F3N3O3/c1-3-31-20(30)14-26-28-21(27-18-11-4-15(2)5-12-18)19(29)13-8-16-6-9-17(10-7-16)22(23,24)25/h4-13,26H,3,14H2,1-2H3,(H,27,28)/b13-8+ |
| InChIKey | ZNFFCQVDZCGDTM-MDWZMJQESA-N |
| XLogP | 3.98 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|