C15H14F6N2O2 — CID 171842735
ethyl (Z)-5-amino-6,6,6-trifluoro-3-[4-(trifluoromethyl)phenyl]iminohex-4-enoate (PubChem CID 171842735) has the molecular formula C15H14F6N2O2 and a molecular weight of 368.28 g/mol. Its IUPAC name is ethyl (Z)-5-amino-6,6,6-trifluoro-3-[4-(trifluoromethyl)phenyl]iminohex-4-enoate.
| Compound Name | ethyl (Z)-5-amino-6,6,6-trifluoro-3-[4-(trifluoromethyl)phenyl]iminohex-4-enoate |
|---|---|
| PubChem CID | 171842735 |
| Molecular Formula | C15H14F6N2O2 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | ethyl (Z)-5-amino-6,6,6-trifluoro-3-[4-(trifluoromethyl)phenyl]iminohex-4-enoate |
| SMILES | CCOC(=O)CC(/C=C(\N)C(F)(F)F)=N\c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H14F6N2O2/c1-2-25-13(24)8-11(7-12(22)15(19,20)21)23-10-5-3-9(4-6-10)14(16,17)18/h3-7H,2,8,22H2,1H3/b12-7-,23-11- |
| InChIKey | SMUNGCLFGMEVGV-OQJBJUIYSA-N |
| XLogP | 4.14 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|