C13H19F2N4O2+ — CID 177019116
ethyl (Z)-5-amino-6,6-difluoro-3-[(2-methyl-1H-pyrazol-2-ium-3-yl)imino]hept-4-enoate (PubChem CID 177019116) has the molecular formula C13H19F2N4O2+ and a molecular weight of 301.32 g/mol. Its IUPAC name is ethyl (Z)-5-amino-6,6-difluoro-3-[(2-methyl-1H-pyrazol-2-ium-3-yl)imino]hept-4-enoate.
| Compound Name | ethyl (Z)-5-amino-6,6-difluoro-3-[(2-methyl-1H-pyrazol-2-ium-3-yl)imino]hept-4-enoate |
|---|---|
| PubChem CID | 177019116 |
| Molecular Formula | C13H19F2N4O2+ |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | ethyl (Z)-5-amino-6,6-difluoro-3-[(2-methyl-1H-pyrazol-2-ium-3-yl)imino]hept-4-enoate |
| SMILES | CCOC(=O)CC(/C=C(\N)C(C)(F)F)=N\c1cc[nH][n+]1C |
| InChI | InChI=1S/C13H18F2N4O2/c1-4-21-12(20)8-9(7-10(16)13(2,14)15)18-11-5-6-17-19(11)3/h5-7H,4,8H2,1-3H3,(H2,16,17,18)/p+1 |
| InChIKey | RLODAZDXJBTJQV-UHFFFAOYSA-O |
| XLogP | 1.36 |
| TPSA | 84.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|