C10H11F3N2S — CID 3311
ethyl N'-[4-(trifluoromethyl)phenyl]carbamimidothioate (PubChem CID 3311) has the molecular formula C10H11F3N2S and a molecular weight of 248.27 g/mol. Its IUPAC name is ethyl N'-[4-(trifluoromethyl)phenyl]carbamimidothioate.
| Compound Name | ethyl N'-[4-(trifluoromethyl)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 3311 |
| Molecular Formula | C10H11F3N2S |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | ethyl N'-[4-(trifluoromethyl)phenyl]carbamimidothioate |
| SMILES | CCS/C(N)=N\c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11F3N2S/c1-2-16-9(14)15-8-5-3-7(4-6-8)10(11,12)13/h3-6H,2H2,1H3,(H2,14,15) |
| InChIKey | LCMOXIFARISMOH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|