C12H13F3N4 — CID 154021871
5-methyl-N'-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 154021871) has the molecular formula C12H13F3N4 and a molecular weight of 270.26 g/mol. Its IUPAC name is 5-methyl-N'-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-methyl-N'-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 154021871 |
| Molecular Formula | C12H13F3N4 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 5-methyl-N'-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CC1=NN(/C(N)=N/c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C12H13F3N4/c1-8-6-7-19(18-8)11(16)17-10-4-2-9(3-5-10)12(13,14)15/h2-5H,6-7H2,1H3,(H2,16,17) |
| InChIKey | UZCPESBUOZOXMB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|