C12H11F3N2O2 — CID 152866492
2-(aminomethylidene)-3-[4-(trifluoromethyl)phenyl]iminobutanoic acid (PubChem CID 152866492) has the molecular formula C12H11F3N2O2 and a molecular weight of 272.23 g/mol. Its IUPAC name is 2-(aminomethylidene)-3-[4-(trifluoromethyl)phenyl]iminobutanoic acid.
| Compound Name | 2-(aminomethylidene)-3-[4-(trifluoromethyl)phenyl]iminobutanoic acid |
|---|---|
| PubChem CID | 152866492 |
| Molecular Formula | C12H11F3N2O2 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-(aminomethylidene)-3-[4-(trifluoromethyl)phenyl]iminobutanoic acid |
| SMILES | C/C(=N\c1ccc(C(F)(F)F)cc1)C(=CN)C(=O)O |
| InChI | InChI=1S/C12H11F3N2O2/c1-7(10(6-16)11(18)19)17-9-4-2-8(3-5-9)12(13,14)15/h2-6H,16H2,1H3,(H,18,19)/b10-6?,17-7+ |
| InChIKey | INETZOKWICCWLP-PLFNJPNWSA-N |
| XLogP | 2.72 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|