C10H8F3NO — CID 166931724
1-[(E)-2-nitrosoprop-1-enyl]-4-(trifluoromethyl)benzene (PubChem CID 166931724) has the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. Its IUPAC name is 1-[(E)-2-nitrosoprop-1-enyl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[(E)-2-nitrosoprop-1-enyl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 166931724 |
| Molecular Formula | C10H8F3NO |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 1-[(E)-2-nitrosoprop-1-enyl]-4-(trifluoromethyl)benzene |
| SMILES | C/C(=C\c1ccc(C(F)(F)F)cc1)N=O |
| InChI | InChI=1S/C10H8F3NO/c1-7(14-15)6-8-2-4-9(5-3-8)10(11,12)13/h2-6H,1H3/b7-6+ |
| InChIKey | QGLUBECOUQRVIL-VOTSOKGWSA-N |
| XLogP | 3.83 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |