C13H14F3NOS — CID 153347012
(E)-N-ethylsulfanyl-2-methyl-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 153347012) has the molecular formula C13H14F3NOS and a molecular weight of 289.32 g/mol. Its IUPAC name is (E)-N-ethylsulfanyl-2-methyl-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-ethylsulfanyl-2-methyl-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 153347012 |
| Molecular Formula | C13H14F3NOS |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | (E)-N-ethylsulfanyl-2-methyl-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCSNC(=O)/C(C)=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F3NOS/c1-3-19-17-12(18)9(2)8-10-4-6-11(7-5-10)13(14,15)16/h4-8H,3H2,1-2H3,(H,17,18)/b9-8+ |
| InChIKey | GOYJRXMYSLVVNG-CMDGGOBGSA-N |
| XLogP | 3.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|