C14H15F3 — CID 44604603
1-[(1E)-2-methylhexa-1,5-dienyl]-4-(trifluoromethyl)benzene (PubChem CID 44604603) has the molecular formula C14H15F3 and a molecular weight of 240.27 g/mol. Its IUPAC name is 1-[(1E)-2-methylhexa-1,5-dienyl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[(1E)-2-methylhexa-1,5-dienyl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 44604603 |
| Molecular Formula | C14H15F3 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 1-[(1E)-2-methylhexa-1,5-dienyl]-4-(trifluoromethyl)benzene |
| SMILES | C=CCC/C(C)=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H15F3/c1-3-4-5-11(2)10-12-6-8-13(9-7-12)14(15,16)17/h3,6-10H,1,4-5H2,2H3/b11-10+ |
| InChIKey | KJBRXRRLXIXQBD-ZHACJKMWSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|